C22H23Cl2NO4 — CID 167314933
(4-phenylpiperidin-4-yl) (E)-3-(3,5-dichloro-2,6-dimethoxyphenyl)prop-2-enoate (PubChem CID 167314933) has the molecular formula C22H23Cl2NO4 and a molecular weight of 436.34 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) (E)-3-(3,5-dichloro-2,6-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-phenylpiperidin-4-yl) (E)-3-(3,5-dichloro-2,6-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 167314933 |
| Molecular Formula | C22H23Cl2NO4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (4-phenylpiperidin-4-yl) (E)-3-(3,5-dichloro-2,6-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1c(Cl)cc(Cl)c(OC)c1/C=C/C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C22H23Cl2NO4/c1-27-20-16(21(28-2)18(24)14-17(20)23)8-9-19(26)29-22(10-12-25-13-11-22)15-6-4-3-5-7-15/h3-9,14,25H,10-13H2,1-2H3/b9-8+ |
| InChIKey | ABRNWMQKDONEEI-CMDGGOBGSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|