C19H32NO2+ — CID 167315273
2-piperidin-1-ium-4-ylpropan-2-yl adamantane-2-carboxylate (PubChem CID 167315273) has the molecular formula C19H32NO2+ and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl adamantane-2-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl adamantane-2-carboxylate |
|---|---|
| PubChem CID | 167315273 |
| Molecular Formula | C19H32NO2+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl adamantane-2-carboxylate |
| SMILES | CC(C)(OC(=O)C1C2CC3CC(C2)CC1C3)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C19H31NO2/c1-19(2,16-3-5-20-6-4-16)22-18(21)17-14-8-12-7-13(10-14)11-15(17)9-12/h12-17,20H,3-11H2,1-2H3/p+1 |
| InChIKey | OMNAVYUVOWMGKQ-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |