C18H24F2NO2+ — CID 167315858
(4-phenylpiperidin-1-ium-4-yl) 4,4-difluorocyclohexane-1-carboxylate (PubChem CID 167315858) has the molecular formula C18H24F2NO2+ and a molecular weight of 324.39 g/mol. Its IUPAC name is (4-phenylpiperidin-1-ium-4-yl) 4,4-difluorocyclohexane-1-carboxylate.
| Compound Name | (4-phenylpiperidin-1-ium-4-yl) 4,4-difluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167315858 |
| Molecular Formula | C18H24F2NO2+ |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4-phenylpiperidin-1-ium-4-yl) 4,4-difluorocyclohexane-1-carboxylate |
| SMILES | O=C(OC1(c2ccccc2)CC[NH2+]CC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H23F2NO2/c19-18(20)8-6-14(7-9-18)16(22)23-17(10-12-21-13-11-17)15-4-2-1-3-5-15/h1-5,14,21H,6-13H2/p+1 |
| InChIKey | CGKHHEJTDGOJDO-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |