C33H32NO6+ — CID 167315897
(4-phenylpiperidin-1-ium-4-yl) 5-oxo-2-(4-phenylbenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 167315897) has the molecular formula C33H32NO6+ and a molecular weight of 538.62 g/mol. Its IUPAC name is (4-phenylpiperidin-1-ium-4-yl) 5-oxo-2-(4-phenylbenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (4-phenylpiperidin-1-ium-4-yl) 5-oxo-2-(4-phenylbenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 167315897 |
| Molecular Formula | C33H32NO6+ |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (4-phenylpiperidin-1-ium-4-yl) 5-oxo-2-(4-phenylbenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3C2C(=O)OC1(c2ccccc2)CC[NH2+]CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31NO6/c35-30(22-13-11-21(12-14-22)20-7-3-1-4-8-20)38-28-25-19-24-26(31(36)39-29(24)28)27(25)32(37)40-33(15-17-34-18-16-33)23-9-5-2-6-10-23/h1-14,24-29,34H,15-19H2/p+1 |
| InChIKey | JTUQMKRIKKGZDT-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|