C26H31NO6 — CID 167315446
(4-phenylpiperidin-4-yl) 2-(cyclopentanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 167315446) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-(cyclopentanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (4-phenylpiperidin-4-yl) 2-(cyclopentanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 167315446 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-(cyclopentanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3C2C(=O)OC1(c2ccccc2)CCNCC1)C1CCCC1 |
| InChI | InChI=1S/C26H31NO6/c28-23(15-6-4-5-7-15)31-21-18-14-17-19(24(29)32-22(17)21)20(18)25(30)33-26(10-12-27-13-11-26)16-8-2-1-3-9-16/h1-3,8-9,15,17-22,27H,4-7,10-14H2 |
| InChIKey | QLRORGXCMBQLJQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|