C14H18Cl2N2O2 — CID 167323458
(3R)-3-(4,5-dichloro-2-hydroxyphenyl)-3-piperidin-4-ylpropanamide (PubChem CID 167323458) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (3R)-3-(4,5-dichloro-2-hydroxyphenyl)-3-piperidin-4-ylpropanamide.
| Compound Name | (3R)-3-(4,5-dichloro-2-hydroxyphenyl)-3-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 167323458 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (3R)-3-(4,5-dichloro-2-hydroxyphenyl)-3-piperidin-4-ylpropanamide |
| SMILES | NC(=O)C[C@@H](c1cc(Cl)c(Cl)cc1O)C1CCNCC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-11-5-10(13(19)7-12(11)16)9(6-14(17)20)8-1-3-18-4-2-8/h5,7-9,18-19H,1-4,6H2,(H2,17,20)/t9-/m1/s1 |
| InChIKey | UQYCGPVXPYXJDK-SECBINFHSA-N |
| XLogP | 2.66 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |