C7H8Br2N2O2 — CID 16732575
5-bromo-4-(bromomethyl)-2,6-dimethoxypyrimidine (PubChem CID 16732575) has the molecular formula C7H8Br2N2O2 and a molecular weight of 311.96 g/mol. Its IUPAC name is 5-bromo-4-(bromomethyl)-2,6-dimethoxypyrimidine.
| Compound Name | 5-bromo-4-(bromomethyl)-2,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 16732575 |
| Molecular Formula | C7H8Br2N2O2 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 5-bromo-4-(bromomethyl)-2,6-dimethoxypyrimidine |
| SMILES | COc1nc(CBr)c(Br)c(OC)n1 |
| InChI | InChI=1S/C7H8Br2N2O2/c1-12-6-5(9)4(3-8)10-7(11-6)13-2/h3H2,1-2H3 |
| InChIKey | TXNUTTSZWGCHMV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|