C17H24NO5P — CID 167329234
benzyl (2S,4S)-2-tert-butyl-4-deuterio-5-oxo-4-(2-phosphanyloxyethyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 167329234) has the molecular formula C17H24NO5P and a molecular weight of 354.36 g/mol. Its IUPAC name is benzyl (2S,4S)-2-tert-butyl-4-deuterio-5-oxo-4-(2-phosphanyloxyethyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S)-2-tert-butyl-4-deuterio-5-oxo-4-(2-phosphanyloxyethyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 167329234 |
| Molecular Formula | C17H24NO5P |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | benzyl (2S,4S)-2-tert-butyl-4-deuterio-5-oxo-4-(2-phosphanyloxyethyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | [2H][C@]1(CCOP)C(=O)O[C@@H](C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24NO5P/c1-17(2,3)15-18(13(9-10-22-24)14(19)23-15)16(20)21-11-12-7-5-4-6-8-12/h4-8,13,15H,9-11,24H2,1-3H3/t13-,15-/m0/s1/i13D |
| InChIKey | DOCGKSHCKGPNMP-WAGSHDPZSA-N |
| XLogP | 3.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|