C54H52IrN3Si — CID 167331824
[4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-1-(4-phenylphenyl)-2H-benzimidazol-3-ide;iridium(3+) (PubChem CID 167331824) has the molecular formula C54H52IrN3Si and a molecular weight of 963.33 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-1-(4-phenylphenyl)-2H-benzimidazol-3-ide;iridium(3+).
| Compound Name | [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-1-(4-phenylphenyl)-2H-benzimidazol-3-ide;iridium(3+) |
|---|---|
| PubChem CID | 167331824 |
| Molecular Formula | C54H52IrN3Si |
| Molecular Weight | 963.33 g/mol |
| Exact Mass | 963.36 |
| IUPAC Name | [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-1-(4-phenylphenyl)-2H-benzimidazol-3-ide;iridium(3+) |
| SMILES | CC1(C)c2c[c-]c(C3[N-]c4ccccc4N3c3ccc(-c4ccccc4)cc3)cc2-c2ccccc21.C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1CCCC1.[Ir+3] |
| InChI | InChI=1S/C34H26N2.C20H26NSi.Ir/c1-34(2)29-13-7-6-12-27(29)28-22-25(18-21-30(28)34)33-35-31-14-8-9-15-32(31)36(33)26-19-16-24(17-20-26)23-10-4-3-5-11-23;1-22(2,3)20-15-21-19(17-11-5-4-6-12-17)14-18(20)13-16-9-7-8-10-16;/h3-17,19-22,33H,1-2H3;4-6,11,14-16H,7-10,13H2,1-3H3;/q-2;-1;+3 |
| InChIKey | PYCDDDSDEZTCRM-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 30.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.33 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|