About N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide
N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 167339788) has the molecular formula C18H24N4O3S2
and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 167339788 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)C2CCNCC2)ccc1NC(=O)c1nccs1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-12-11-15(3-4-16(12)21-17(23)18-20-9-10-26-18)27(24,25)22-13(2)14-5-7-19-8-6-14/h3-4,9-11,13-14,19,22H,5-8H2,1-2H3,(H,21,23) |
| InChIKey | YDAPRXXAYZRVHA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide (CID 167339788) is N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide is Cc1cc(S(=O)(=O)NC(C)C2CCNCC2)ccc1NC(=O)c1nccs1.
What is the InChIKey of N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide?
The InChIKey is YDAPRXXAYZRVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3S2/c1-12-11-15(3-4-16(12)21-17(23)18-20-9-10-26-18)27(24,25)22-13(2)14-5-7-19-8-6-14/h3-4,9-11,13-14,19,22H,5-8H2,1-2H3,(H,21,23).
What are the key properties of N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide?
N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide has a molecular weight of 408.55 g/mol, XLogP of 2.37, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 167339788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).