C20H28N6O4 — CID 167345462
5-(dihydroxyamino)-3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methylpyridin-2-one (PubChem CID 167345462) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-(dihydroxyamino)-3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methylpyridin-2-one.
| Compound Name | 5-(dihydroxyamino)-3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 167345462 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 5-(dihydroxyamino)-3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methylpyridin-2-one |
| SMILES | C[C@@H]1CN(c2ccc(Nc3cc(N(O)O)cn(C)c3=O)nc2)[C@@H](C)CN1C1COC1 |
| InChI | InChI=1S/C20H28N6O4/c1-13-9-25(17-11-30-12-17)14(2)8-24(13)15-4-5-19(21-7-15)22-18-6-16(26(28)29)10-23(3)20(18)27/h4-7,10,13-14,17,28-29H,8-9,11-12H2,1-3H3,(H,21,22)/t13-,14+/m0/s1 |
| InChIKey | PEMPKNSSVCGMHT-UONOGXRCSA-N |
| XLogP | 1.41 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|