C26H40BN5O4S — CID 164979038
3-[[5-[(2S)-2-ethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;sulfane (PubChem CID 164979038) has the molecular formula C26H40BN5O4S and a molecular weight of 529.52 g/mol. Its IUPAC name is 3-[[5-[(2S)-2-ethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;sulfane.
| Compound Name | 3-[[5-[(2S)-2-ethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;sulfane |
|---|---|
| PubChem CID | 164979038 |
| Molecular Formula | C26H40BN5O4S |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 3-[[5-[(2S)-2-ethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;sulfane |
| SMILES | CC[C@H]1CN(C2COC2)CCN1c1ccc(Nc2cc(B3OC(C)(C)C(C)(C)O3)cn(C)c2=O)nc1.S |
| InChI | InChI=1S/C26H38BN5O4.H2S/c1-7-19-15-31(21-16-34-17-21)10-11-32(19)20-8-9-23(28-13-20)29-22-12-18(14-30(6)24(22)33)27-35-25(2,3)26(4,5)36-27;/h8-9,12-14,19,21H,7,10-11,15-17H2,1-6H3,(H,28,29);1H2/t19-;/m0./s1 |
| InChIKey | FFAZNUHNQCDAPL-FYZYNONXSA-N |
| XLogP | 2.24 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|