C23H34BN5O3 — CID 58043951
3-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 58043951) has the molecular formula C23H34BN5O3 and a molecular weight of 439.37 g/mol. Its IUPAC name is 3-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58043951 |
| Molecular Formula | C23H34BN5O3 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 3-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | CCN1CCN(c2ccc(Nc3cc(B4OC(C)(C)C(C)(C)O4)cn(C)c3=O)nc2)CC1 |
| InChI | InChI=1S/C23H34BN5O3/c1-7-28-10-12-29(13-11-28)18-8-9-20(25-15-18)26-19-14-17(16-27(6)21(19)30)24-31-22(2,3)23(4,5)32-24/h8-9,14-16H,7,10-13H2,1-6H3,(H,25,26) |
| InChIKey | YCXFOCJBBSAXPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|