C19H27BN4O3S — CID 86683938
1-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 86683938) has the molecular formula C19H27BN4O3S and a molecular weight of 402.33 g/mol. Its IUPAC name is 1-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 1-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 86683938 |
| Molecular Formula | C19H27BN4O3S |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-methyl-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | CN1CCc2nc(Nc3cc(B4OC(C)(C)C(C)(C)O4)cn(C)c3=O)sc2C1 |
| InChI | InChI=1S/C19H27BN4O3S/c1-18(2)19(3,4)27-20(26-18)12-9-14(16(25)24(6)10-12)22-17-21-13-7-8-23(5)11-15(13)28-17/h9-10H,7-8,11H2,1-6H3,(H,21,22) |
| InChIKey | ZSIPAGVINNUIAO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|