C25H36BN5O4 — CID 86683929
3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 86683929) has the molecular formula C25H36BN5O4 and a molecular weight of 481.41 g/mol. Its IUPAC name is 3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 86683929 |
| Molecular Formula | C25H36BN5O4 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 3-[[5-[(2S,5R)-2,5-dimethyl-4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-1-methyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | CC1OB(c2cc(Nc3ccc(N4C[C@@H](C)N(C5COC5)C[C@@H]4C)cn3)c(=O)n(C)c2)OC1(C)C |
| InChI | InChI=1S/C25H36BN5O4/c1-16-12-31(21-14-33-15-21)17(2)11-30(16)20-7-8-23(27-10-20)28-22-9-19(13-29(6)24(22)32)26-34-18(3)25(4,5)35-26/h7-10,13,16-18,21H,11-12,14-15H2,1-6H3,(H,27,28)/t16-,17+,18?/m0/s1 |
| InChIKey | JWMRHQVIYUVNAD-MYFVLZFPSA-N |
| XLogP | 1.73 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|