C33H35N — CID 167345490
9-(2,3-ditert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole (PubChem CID 167345490) has the molecular formula C33H35N and a molecular weight of 450.68 g/mol. Its IUPAC name is 9-(2,3-ditert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole.
| Compound Name | 9-(2,3-ditert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole |
|---|---|
| PubChem CID | 167345490 |
| Molecular Formula | C33H35N |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 9-(2,3-ditert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2cccc3c4ccccc4n(-c4cccc(C(C)(C)C)c4C(C)(C)C)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C33H35N/c1-32(2,3)27-19-13-21-29(30(27)33(4,5)6)34-28-20-11-10-17-25(28)26-18-12-16-24(31(26)34)22-23-14-8-7-9-15-23/h7-21H,22H2,1-6H3/i7D,8D,9D,14D,15D |
| InChIKey | OCFATVUMACBASQ-CFPNEJFESA-N |
| XLogP | 8.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |