C34H27NS — CID 153490596
9-[1-tert-butyl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole (PubChem CID 153490596) has the molecular formula C34H27NS and a molecular weight of 486.69 g/mol. Its IUPAC name is 9-[1-tert-butyl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[1-tert-butyl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 153490596 |
| Molecular Formula | C34H27NS |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 9-[1-tert-butyl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3sc4ccc(-n5c6ccccc6c6ccccc65)c(C(C)(C)C)c4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C34H27NS/c1-34(2,3)33-28(35-26-17-9-7-14-24(26)25-15-8-10-18-27(25)35)20-21-30-32(33)31-23(16-11-19-29(31)36-30)22-12-5-4-6-13-22/h4-21H,1-3H3/i4D,5D,6D,12D,13D |
| InChIKey | WANGRAAYELKKPX-RQWUDOQSSA-N |
| XLogP | 10.12 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |