C42H28N2S — CID 170532855
2-carbazol-9-yl-6-dibenzothiophen-1-yl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 170532855) has the molecular formula C42H28N2S and a molecular weight of 597.80 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-dibenzothiophen-1-yl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2-carbazol-9-yl-6-dibenzothiophen-1-yl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 170532855 |
| Molecular Formula | C42H28N2S |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 2-carbazol-9-yl-6-dibenzothiophen-1-yl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(Nc3c(-c4cccc5sc6ccccc6c45)cccc3-n3c4ccccc4c4ccccc43)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C42H28N2S/c1-2-12-28(13-3-1)29-24-26-30(27-25-29)43-42-34(33-17-11-23-40-41(33)35-16-6-9-22-39(35)45-40)18-10-21-38(42)44-36-19-7-4-14-31(36)32-15-5-8-20-37(32)44/h1-27,43H/i1D,2D,3D,12D,13D |
| InChIKey | AAICJIBKUIHZPT-AYAICNHJSA-N |
| XLogP | 12.23 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |