C18H11ClS — CID 176583173
1-(2-chloro-3,4,5,6-tetradeuteriophenyl)dibenzothiophene (PubChem CID 176583173) has the molecular formula C18H11ClS and a molecular weight of 298.83 g/mol. Its IUPAC name is 1-(2-chloro-3,4,5,6-tetradeuteriophenyl)dibenzothiophene.
| Compound Name | 1-(2-chloro-3,4,5,6-tetradeuteriophenyl)dibenzothiophene |
|---|---|
| PubChem CID | 176583173 |
| Molecular Formula | C18H11ClS |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-(2-chloro-3,4,5,6-tetradeuteriophenyl)dibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3sc4ccccc4c23)c(Cl)c1[2H] |
| InChI | InChI=1S/C18H11ClS/c19-15-9-3-1-6-12(15)13-8-5-11-17-18(13)14-7-2-4-10-16(14)20-17/h1-11H/i1D,3D,6D,9D |
| InChIKey | XHDSLPQXYLYNGH-JAIHYKQQSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |