C33H18ClN3OS — CID 171587108
2-(6-chloro-2,4,7,8-tetradeuteriodibenzofuran-1-yl)-4-dibenzothiophen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 171587108) has the molecular formula C33H18ClN3OS and a molecular weight of 549.10 g/mol. Its IUPAC name is 2-(6-chloro-2,4,7,8-tetradeuteriodibenzofuran-1-yl)-4-dibenzothiophen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(6-chloro-2,4,7,8-tetradeuteriodibenzofuran-1-yl)-4-dibenzothiophen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171587108 |
| Molecular Formula | C33H18ClN3OS |
| Molecular Weight | 549.10 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 2-(6-chloro-2,4,7,8-tetradeuteriodibenzofuran-1-yl)-4-dibenzothiophen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1cc2c(oc3c([2H])cc([2H])c(-c4nc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])nc(-c5cccc6sc7ccccc7c56)n4)c32)c(Cl)c1[2H] |
| InChI | InChI=1S/C33H18ClN3OS/c34-24-15-6-12-21-28-22(13-7-16-25(28)38-30(21)24)32-35-31(19-9-2-1-3-10-19)36-33(37-32)23-14-8-18-27-29(23)20-11-4-5-17-26(20)39-27/h1-18H/i1D,2D,3D,6D,9D,10D,13D,15D,16D |
| InChIKey | YDCYMESQLWGDMM-BVXDZVCYSA-N |
| XLogP | 9.79 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.10 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |