C47H29N3O — CID 170927066
2-(2,3,4,5,6-pentadeuteriophenyl)-4-(6-phenylnaphthalen-2-yl)-6-(2,4,7,8-tetradeuterio-6-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 170927066) has the molecular formula C47H29N3O and a molecular weight of 660.82 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-4-(6-phenylnaphthalen-2-yl)-6-(2,4,7,8-tetradeuterio-6-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-(6-phenylnaphthalen-2-yl)-6-(2,4,7,8-tetradeuterio-6-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170927066 |
| Molecular Formula | C47H29N3O |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-(6-phenylnaphthalen-2-yl)-6-(2,4,7,8-tetradeuterio-6-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1cc2c(oc3c([2H])cc([2H])c(-c4nc(-c5ccc6cc(-c7ccccc7)ccc6c5)nc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])n4)c32)c(-c2ccc3ccccc3c2)c1[2H] |
| InChI | InChI=1S/C47H29N3O/c1-3-11-30(12-4-1)34-22-23-36-29-38(26-24-35(36)27-34)46-48-45(32-14-5-2-6-15-32)49-47(50-46)41-19-10-20-42-43(41)40-18-9-17-39(44(40)51-42)37-25-21-31-13-7-8-16-33(31)28-37/h1-29H/i2D,5D,6D,9D,14D,15D,17D,19D,20D |
| InChIKey | MZCZTFLBABXEGW-HSSQLLEESA-N |
| XLogP | 12.41 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |