C47H29N3O — CID 176616683
2-(2,4,6,7,8,9-hexadeuteriodibenzofuran-1-yl)-4-naphthalen-2-yl-6-[3-naphthalen-2-yl-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine (PubChem CID 176616683) has the molecular formula C47H29N3O and a molecular weight of 662.84 g/mol. Its IUPAC name is 2-(2,4,6,7,8,9-hexadeuteriodibenzofuran-1-yl)-4-naphthalen-2-yl-6-[3-naphthalen-2-yl-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(2,4,6,7,8,9-hexadeuteriodibenzofuran-1-yl)-4-naphthalen-2-yl-6-[3-naphthalen-2-yl-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176616683 |
| Molecular Formula | C47H29N3O |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 2-(2,4,6,7,8,9-hexadeuteriodibenzofuran-1-yl)-4-naphthalen-2-yl-6-[3-naphthalen-2-yl-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1cc([2H])c2oc3c([2H])c([2H])c([2H])c([2H])c3c2c1-c1nc(-c2ccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c(-c3ccc4ccccc4c3)c2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C47H29N3O/c1-2-13-32(14-3-1)38-26-25-37(29-41(38)35-23-21-30-11-4-6-15-33(30)27-35)46-48-45(36-24-22-31-12-5-7-16-34(31)28-36)49-47(50-46)40-18-10-20-43-44(40)39-17-8-9-19-42(39)51-43/h1-29H/i1D,2D,3D,8D,9D,13D,14D,17D,18D,19D,20D |
| InChIKey | NGPMWOCRRYEXTG-UPVXUTQLSA-N |
| XLogP | 12.41 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |