C36H23NO2S — CID 169289739
1-[5-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-nitrophenyl]dibenzothiophene (PubChem CID 169289739) has the molecular formula C36H23NO2S and a molecular weight of 543.71 g/mol. Its IUPAC name is 1-[5-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-nitrophenyl]dibenzothiophene.
| Compound Name | 1-[5-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-nitrophenyl]dibenzothiophene |
|---|---|
| PubChem CID | 169289739 |
| Molecular Formula | C36H23NO2S |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 1-[5-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-nitrophenyl]dibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3ccc([N+](=O)[O-])c(-c4cccc5sc6ccccc6c45)c3)cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H23NO2S/c38-37(39)33-19-18-26(23-32(33)30-15-9-17-35-36(30)31-14-7-8-16-34(31)40-35)29-21-27(24-10-3-1-4-11-24)20-28(22-29)25-12-5-2-6-13-25/h1-23H/i1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | IFLUIRRLZVWTIM-KJIKOLQBSA-N |
| XLogP | 10.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|