C29H27N — CID 167345523
9-(2-tert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole (PubChem CID 167345523) has the molecular formula C29H27N and a molecular weight of 394.57 g/mol. Its IUPAC name is 9-(2-tert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole.
| Compound Name | 9-(2-tert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole |
|---|---|
| PubChem CID | 167345523 |
| Molecular Formula | C29H27N |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 9-(2-tert-butylphenyl)-1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2cccc3c4ccccc4n(-c4ccccc4C(C)(C)C)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C29H27N/c1-29(2,3)25-17-8-10-19-27(25)30-26-18-9-7-15-23(26)24-16-11-14-22(28(24)30)20-21-12-5-4-6-13-21/h4-19H,20H2,1-3H3/i4D,5D,6D,12D,13D |
| InChIKey | LAOZPKSVRAMWOY-RQWUDOQSSA-N |
| XLogP | 7.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |