C14H28N2O5P- — CID 167351538
[(3R,5S)-1-(6-aminohexanoyl)-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-propan-2-ylphosphinate (PubChem CID 167351538) has the molecular formula C14H28N2O5P- and a molecular weight of 335.36 g/mol. Its IUPAC name is [(3R,5S)-1-(6-aminohexanoyl)-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-propan-2-ylphosphinate.
| Compound Name | [(3R,5S)-1-(6-aminohexanoyl)-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-propan-2-ylphosphinate |
|---|---|
| PubChem CID | 167351538 |
| Molecular Formula | C14H28N2O5P- |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3R,5S)-1-(6-aminohexanoyl)-5-(hydroxymethyl)pyrrolidin-3-yl]oxy-propan-2-ylphosphinate |
| SMILES | CC(C)P(=O)([O-])O[C@@H]1C[C@@H](CO)N(C(=O)CCCCCN)C1 |
| InChI | InChI=1S/C14H29N2O5P/c1-11(2)22(19,20)21-13-8-12(10-17)16(9-13)14(18)6-4-3-5-7-15/h11-13,17H,3-10,15H2,1-2H3,(H,19,20)/p-1/t12-,13+/m0/s1 |
| InChIKey | QJJCQSCIDQGKOI-QWHCGFSZSA-M |
| XLogP | 0.45 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|