C13H26N2O6P- — CID 140856424
[(2S,4R)-1-(6-aminohexanoyl)-4-hydroxypyrrolidin-2-yl]methyl ethyl phosphate (PubChem CID 140856424) has the molecular formula C13H26N2O6P- and a molecular weight of 337.33 g/mol. Its IUPAC name is [(2S,4R)-1-(6-aminohexanoyl)-4-hydroxypyrrolidin-2-yl]methyl ethyl phosphate.
| Compound Name | [(2S,4R)-1-(6-aminohexanoyl)-4-hydroxypyrrolidin-2-yl]methyl ethyl phosphate |
|---|---|
| PubChem CID | 140856424 |
| Molecular Formula | C13H26N2O6P- |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(2S,4R)-1-(6-aminohexanoyl)-4-hydroxypyrrolidin-2-yl]methyl ethyl phosphate |
| SMILES | CCOP(=O)([O-])OC[C@@H]1C[C@@H](O)CN1C(=O)CCCCCN |
| InChI | InChI=1S/C13H27N2O6P/c1-2-20-22(18,19)21-10-11-8-12(16)9-15(11)13(17)6-4-3-5-7-14/h11-12,16H,2-10,14H2,1H3,(H,18,19)/p-1/t11-,12+/m0/s1 |
| InChIKey | VBHGLYCMQWBUEJ-NWDGAFQWSA-M |
| XLogP | -0.01 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|