C11H21NO8P- — CID 176722805
hydroxy [(2S,4R)-4-hydroxy-1-(6-hydroxyhexanoyl)pyrrolidin-2-yl]methyl phosphate (PubChem CID 176722805) has the molecular formula C11H21NO8P- and a molecular weight of 326.26 g/mol. Its IUPAC name is hydroxy [(2S,4R)-4-hydroxy-1-(6-hydroxyhexanoyl)pyrrolidin-2-yl]methyl phosphate.
| Compound Name | hydroxy [(2S,4R)-4-hydroxy-1-(6-hydroxyhexanoyl)pyrrolidin-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 176722805 |
| Molecular Formula | C11H21NO8P- |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | hydroxy [(2S,4R)-4-hydroxy-1-(6-hydroxyhexanoyl)pyrrolidin-2-yl]methyl phosphate |
| SMILES | O=C(CCCCCO)N1C[C@H](O)C[C@H]1COP(=O)([O-])OO |
| InChI | InChI=1S/C11H22NO8P/c13-5-3-1-2-4-11(15)12-7-10(14)6-9(12)8-19-21(17,18)20-16/h9-10,13-14,16H,1-8H2,(H,17,18)/p-1/t9-,10+/m0/s1 |
| InChIKey | RBYNGPXUNDIOPU-VHSXEESVSA-M |
| XLogP | -0.52 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|