C20H38NO6P — CID 58271366
1-[(2S,4S)-4-hydroxy-2-[2-[2-hydroxyethoxy(methyl)phosphoryl]ethyl]pyrrolidin-1-yl]undecane-1,10-dione (PubChem CID 58271366) has the molecular formula C20H38NO6P and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[(2S,4S)-4-hydroxy-2-[2-[2-hydroxyethoxy(methyl)phosphoryl]ethyl]pyrrolidin-1-yl]undecane-1,10-dione.
| Compound Name | 1-[(2S,4S)-4-hydroxy-2-[2-[2-hydroxyethoxy(methyl)phosphoryl]ethyl]pyrrolidin-1-yl]undecane-1,10-dione |
|---|---|
| PubChem CID | 58271366 |
| Molecular Formula | C20H38NO6P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-[(2S,4S)-4-hydroxy-2-[2-[2-hydroxyethoxy(methyl)phosphoryl]ethyl]pyrrolidin-1-yl]undecane-1,10-dione |
| SMILES | CC(=O)CCCCCCCCC(=O)N1C[C@@H](O)C[C@H]1CCP(C)(=O)OCCO |
| InChI | InChI=1S/C20H38NO6P/c1-17(23)9-7-5-3-4-6-8-10-20(25)21-16-19(24)15-18(21)11-14-28(2,26)27-13-12-22/h18-19,22,24H,3-16H2,1-2H3/t18-,19+,28?/m1/s1 |
| InChIKey | JWYSBOCLSCCUKT-ZUDGUFDASA-N |
| XLogP | 2.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|