C19H30NO3Os — CID 163827777
1-[(2S,4R)-2-ethynyl-4-hydroxypyrrolidin-1-yl]tridecane-1,12-dione;osmium(1+) (PubChem CID 163827777) has the molecular formula C19H30NO3Os and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-[(2S,4R)-2-ethynyl-4-hydroxypyrrolidin-1-yl]tridecane-1,12-dione;osmium(1+).
| Compound Name | 1-[(2S,4R)-2-ethynyl-4-hydroxypyrrolidin-1-yl]tridecane-1,12-dione;osmium(1+) |
|---|---|
| PubChem CID | 163827777 |
| Molecular Formula | C19H30NO3Os |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 1-[(2S,4R)-2-ethynyl-4-hydroxypyrrolidin-1-yl]tridecane-1,12-dione;osmium(1+) |
| SMILES | [C-]#C[C@@H]1C[C@@H](O)CN1C(=O)CCCCCCCCCCC(C)=O.[Os+] |
| InChI | InChI=1S/C19H30NO3.Os/c1-3-17-14-18(22)15-20(17)19(23)13-11-9-7-5-4-6-8-10-12-16(2)21;/h17-18,22H,4-15H2,2H3;/q-1;+1/t17-,18-;/m1./s1 |
| InChIKey | QPEBVVKMGKRXCP-JAXOOIEVSA-N |
| XLogP | 3.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|