C49H48N6O — CID 167351734
14-(4-tert-butylphenyl)-12-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene (PubChem CID 167351734) has the molecular formula C49H48N6O and a molecular weight of 736.96 g/mol. Its IUPAC name is 14-(4-tert-butylphenyl)-12-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene.
| Compound Name | 14-(4-tert-butylphenyl)-12-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene |
|---|---|
| PubChem CID | 167351734 |
| Molecular Formula | C49H48N6O |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.39 |
| IUPAC Name | 14-(4-tert-butylphenyl)-12-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene |
| SMILES | CC(C)(C)c1ccc(N2CN(c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3cc4nc5n(c4cc32)CCCC5)cc1 |
| InChI | InChI=1S/C49H48N6O/c1-48(2,3)32-17-19-34(20-18-32)53-31-54(44-29-40-43(30-45(44)53)52-25-10-9-16-46(52)51-40)35-12-11-13-36(27-35)56-37-21-22-39-38-14-7-8-15-41(38)55(42(39)28-37)47-26-33(23-24-50-47)49(4,5)6/h7-8,11-15,17-24,26-30H,9-10,16,25,31H2,1-6H3 |
| InChIKey | YCXFVNIGZFXADD-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |