C44H45N6O+ — CID 167351829
12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-14-methyl-2,8,12-triaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15),13-pentaene (PubChem CID 167351829) has the molecular formula C44H45N6O+ and a molecular weight of 673.89 g/mol. Its IUPAC name is 12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-14-methyl-2,8,12-triaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15),13-pentaene.
| Compound Name | 12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-14-methyl-2,8,12-triaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15),13-pentaene |
|---|---|
| PubChem CID | 167351829 |
| Molecular Formula | C44H45N6O+ |
| Molecular Weight | 673.89 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | 12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-14-methyl-2,8,12-triaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15),13-pentaene |
| SMILES | C[n+]1cn(-c2cccc(Oc3ccc4c5cc(C(C)(C)C)ccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c2cc3nc4n(c3cc21)CCCC4 |
| InChI | InChI=1S/C44H45N6O/c1-43(2,3)28-14-17-36-34(21-28)33-16-15-32(24-37(33)50(36)42-22-29(18-19-45-42)44(4,5)6)51-31-12-10-11-30(23-31)49-27-47(7)39-26-38-35(25-40(39)49)46-41-13-8-9-20-48(38)41/h10-12,14-19,21-27H,8-9,13,20H2,1-7H3/q+1 |
| InChIKey | OAUPTGBHIQZFNR-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 53.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.89 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|