C47H52N6O — CID 167351927
14-tert-butyl-12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene (PubChem CID 167351927) has the molecular formula C47H52N6O and a molecular weight of 716.97 g/mol. Its IUPAC name is 14-tert-butyl-12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene.
| Compound Name | 14-tert-butyl-12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene |
|---|---|
| PubChem CID | 167351927 |
| Molecular Formula | C47H52N6O |
| Molecular Weight | 716.97 g/mol |
| Exact Mass | 716.42 |
| IUPAC Name | 14-tert-butyl-12-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2,8,12,14-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),7,9,11(15)-tetraene |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccc(C(C)(C)C)cc3c3ccc(Oc4cccc(N5CN(C(C)(C)C)c6cc7c(cc65)nc5n7CCCC5)c4)cc32)c1 |
| InChI | InChI=1S/C47H52N6O/c1-45(2,3)30-16-19-38-36(23-30)35-18-17-34(26-39(35)53(38)44-24-31(20-21-48-44)46(4,5)6)54-33-14-12-13-32(25-33)51-29-52(47(7,8)9)42-28-40-37(27-41(42)51)49-43-15-10-11-22-50(40)43/h12-14,16-21,23-28H,10-11,15,22,29H2,1-9H3 |
| InChIKey | VNRFZDCJWPKBCQ-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.97 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |