C8H10F5NO2 — CID 167353316
2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-methyl-N-prop-2-enylpropanamide (PubChem CID 167353316) has the molecular formula C8H10F5NO2 and a molecular weight of 247.16 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 167353316 |
| Molecular Formula | C8H10F5NO2 |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)C(F)(OCF)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO2/c1-3-4-14(2)6(15)7(10,16-5-9)8(11,12)13/h3H,1,4-5H2,2H3 |
| InChIKey | CPBNKLDJRHNNCG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|