C36H46BIrN4O2S- — CID 167354090
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-methyl-7-(3-methyl-1,3,2-benzodiazaborol-1-id-2-yl)-2-(2,4,6-trimethylphenyl)thieno[2,3-d]pyridazine (PubChem CID 167354090) has the molecular formula C36H46BIrN4O2S- and a molecular weight of 801.89 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-methyl-7-(3-methyl-1,3,2-benzodiazaborol-1-id-2-yl)-2-(2,4,6-trimethylphenyl)thieno[2,3-d]pyridazine.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-methyl-7-(3-methyl-1,3,2-benzodiazaborol-1-id-2-yl)-2-(2,4,6-trimethylphenyl)thieno[2,3-d]pyridazine |
|---|---|
| PubChem CID | 167354090 |
| Molecular Formula | C36H46BIrN4O2S- |
| Molecular Weight | 801.89 g/mol |
| Exact Mass | 802.31 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;3-methyl-7-(3-methyl-1,3,2-benzodiazaborol-1-id-2-yl)-2-(2,4,6-trimethylphenyl)thieno[2,3-d]pyridazine |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c(-c2sc3c(B4[N-]c5ccccc5N4C)nncc3c2C)c(C)c1.[Ir] |
| InChI | InChI=1S/C23H22BN4S.C13H24O2.Ir/c1-13-10-14(2)20(15(3)11-13)21-16(4)17-12-25-27-23(22(17)29-21)24-26-18-8-6-7-9-19(18)28(24)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-12H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | RBYPPSUEDHLEBN-DZTQYQPZSA-N |
| XLogP | 9.31 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.89 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|