C29H36N2O7 — CID 16735784
tert-butyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[4-methoxy-3-(methoxycarbamoyl)-5-methylphenyl]hex-5-enoate (PubChem CID 16735784) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is tert-butyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[4-methoxy-3-(methoxycarbamoyl)-5-methylphenyl]hex-5-enoate.
| Compound Name | tert-butyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[4-methoxy-3-(methoxycarbamoyl)-5-methylphenyl]hex-5-enoate |
|---|---|
| PubChem CID | 16735784 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | tert-butyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[4-methoxy-3-(methoxycarbamoyl)-5-methylphenyl]hex-5-enoate |
| SMILES | CONC(=O)c1cc(/C(=C\CCCC(=O)OC(C)(C)C)c2cc(C)c3oc(=O)n(C)c3c2)cc(C)c1OC |
| InChI | InChI=1S/C29H36N2O7/c1-17-13-19(15-22(25(17)35-7)27(33)30-36-8)21(11-9-10-12-24(32)38-29(3,4)5)20-14-18(2)26-23(16-20)31(6)28(34)37-26/h11,13-16H,9-10,12H2,1-8H3,(H,30,33)/b21-11+ |
| InChIKey | UFXGNPYICJHKOU-SRZZPIQSSA-N |
| XLogP | 4.99 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|