C26H29ClN2O5S — CID 127044752
S-methyl 5-[(E,6Z)-6-chloro-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxyiminohex-1-enyl]-2-methoxy-3-methylbenzenecarbothioate (PubChem CID 127044752) has the molecular formula C26H29ClN2O5S and a molecular weight of 517.05 g/mol. Its IUPAC name is S-methyl 5-[(E,6Z)-6-chloro-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxyiminohex-1-enyl]-2-methoxy-3-methylbenzenecarbothioate.
| Compound Name | S-methyl 5-[(E,6Z)-6-chloro-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxyiminohex-1-enyl]-2-methoxy-3-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 127044752 |
| Molecular Formula | C26H29ClN2O5S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | S-methyl 5-[(E,6Z)-6-chloro-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxyiminohex-1-enyl]-2-methoxy-3-methylbenzenecarbothioate |
| SMILES | CO/N=C(\Cl)CCC/C=C(\c1cc(C)c(OC)c(C(=O)SC)c1)c1cc(C)c2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C26H29ClN2O5S/c1-15-11-17(13-20(23(15)32-4)25(30)35-6)19(9-7-8-10-22(27)28-33-5)18-12-16(2)24-21(14-18)29(3)26(31)34-24/h9,11-14H,7-8,10H2,1-6H3/b19-9+,28-22- |
| InChIKey | NFSVJQIMGDIFSY-MCPDHPEYSA-N |
| XLogP | 6.06 |
| TPSA | 83.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|