C25H26ClNO7 — CID 6483640
methyl 3-chloro-5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxy-6-oxohex-1-enyl]-2-methoxybenzoate (PubChem CID 6483640) has the molecular formula C25H26ClNO7 and a molecular weight of 487.94 g/mol. Its IUPAC name is methyl 3-chloro-5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxy-6-oxohex-1-enyl]-2-methoxybenzoate.
| Compound Name | methyl 3-chloro-5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxy-6-oxohex-1-enyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 6483640 |
| Molecular Formula | C25H26ClNO7 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | methyl 3-chloro-5-[(E)-1-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-methoxy-6-oxohex-1-enyl]-2-methoxybenzoate |
| SMILES | COC(=O)CCC/C=C(/c1cc(Cl)c(OC)c(C(=O)OC)c1)c1cc(C)c2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C25H26ClNO7/c1-14-10-15(13-20-22(14)34-25(30)27(20)2)17(8-6-7-9-21(28)31-3)16-11-18(24(29)33-5)23(32-4)19(26)12-16/h8,10-13H,6-7,9H2,1-5H3/b17-8+ |
| InChIKey | JOMAHATZNUDXIJ-CAOOACKPSA-N |
| XLogP | 4.66 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|