C31H34N4O3S2 — CID 167358926
N-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[4-naphthalen-2-yl-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 167358926) has the molecular formula C31H34N4O3S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is N-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[4-naphthalen-2-yl-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | N-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[4-naphthalen-2-yl-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 167358926 |
| Molecular Formula | C31H34N4O3S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | N-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-2-[4-naphthalen-2-yl-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cc(-c2ccc3ccccc3c2)cc(C(C)C)c1CC(=O)N=S(=O)(NC#N)c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C31H34N4O3S2/c1-19(2)25-14-24(23-12-11-21-9-7-8-10-22(21)13-23)15-26(20(3)4)27(25)16-28(36)35-40(38,34-18-32)29-17-33-30(39-29)31(5,6)37/h7-15,17,19-20,37H,16H2,1-6H3,(H,34,35,36,38) |
| InChIKey | ZSDYNZNSXDVPKE-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|