C27H36IrNO2- — CID 167366150
iridium;1-methanidyl-6-(2-methanidylphenyl)-2,4-dimethyl-3-phenylpyridin-1-ium;bis(propan-2-ol) (PubChem CID 167366150) has the molecular formula C27H36IrNO2- and a molecular weight of 598.81 g/mol. Its IUPAC name is iridium;1-methanidyl-6-(2-methanidylphenyl)-2,4-dimethyl-3-phenylpyridin-1-ium;bis(propan-2-ol).
| Compound Name | iridium;1-methanidyl-6-(2-methanidylphenyl)-2,4-dimethyl-3-phenylpyridin-1-ium;bis(propan-2-ol) |
|---|---|
| PubChem CID | 167366150 |
| Molecular Formula | C27H36IrNO2- |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | iridium;1-methanidyl-6-(2-methanidylphenyl)-2,4-dimethyl-3-phenylpyridin-1-ium;bis(propan-2-ol) |
| SMILES | CC(C)O.CC(C)O.[CH2-]c1ccccc1-c1cc(C)c(-c2ccccc2)c(C)[n+]1[CH2-].[Ir] |
| InChI | InChI=1S/C21H20N.2C3H8O.Ir/c1-15-10-8-9-13-19(15)20-14-16(2)21(17(3)22(20)4)18-11-6-5-7-12-18;2*1-3(2)4;/h5-14H,1,4H2,2-3H3;2*3-4H,1-2H3;/q-1;;; |
| InChIKey | RYPSRZJTWCHMKA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|