C14H20O4 — CID 16736820
2-acetyl-4,6,6-triethyl-3,5-dihydroxycyclohexa-2,4-dien-1-one (PubChem CID 16736820) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-acetyl-4,6,6-triethyl-3,5-dihydroxycyclohexa-2,4-dien-1-one.
| Compound Name | 2-acetyl-4,6,6-triethyl-3,5-dihydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 16736820 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-acetyl-4,6,6-triethyl-3,5-dihydroxycyclohexa-2,4-dien-1-one |
| SMILES | CCC1=C(O)C(CC)(CC)C(=O)C(C(C)=O)=C1O |
| InChI | InChI=1S/C14H20O4/c1-5-9-11(16)10(8(4)15)13(18)14(6-2,7-3)12(9)17/h16-17H,5-7H2,1-4H3 |
| InChIKey | XJWRUJHZBBZGDW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|