C29H31F2N3O6S — CID 16736911
4-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]methyl]piperazine-1-sulfonic acid (PubChem CID 16736911) has the molecular formula C29H31F2N3O6S and a molecular weight of 587.65 g/mol. Its IUPAC name is 4-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]methyl]piperazine-1-sulfonic acid.
| Compound Name | 4-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]methyl]piperazine-1-sulfonic acid |
|---|---|
| PubChem CID | 16736911 |
| Molecular Formula | C29H31F2N3O6S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 4-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl]methyl]piperazine-1-sulfonic acid |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(CN3CCN(S(=O)(=O)O)CC3)cc2O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C29H31F2N3O6S/c30-21-4-2-20(3-5-21)26(35)12-11-25-28(34(29(25)37)23-8-6-22(31)7-9-23)24-10-1-19(17-27(24)36)18-32-13-15-33(16-14-32)41(38,39)40/h1-10,17,25-26,28,35-36H,11-16,18H2,(H,38,39,40)/t25-,26+,28-/m1/s1 |
| InChIKey | NXLFPXQQINKAKD-FULLSBAXSA-N |
| XLogP | 3.81 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|