C32H28BrF2NO4 — CID 143466365
(4S)-4-[4-[[4-(bromomethyl)phenyl]methoxy]-2-hydroxyphenyl]-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one (PubChem CID 143466365) has the molecular formula C32H28BrF2NO4 and a molecular weight of 608.48 g/mol. Its IUPAC name is (4S)-4-[4-[[4-(bromomethyl)phenyl]methoxy]-2-hydroxyphenyl]-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one.
| Compound Name | (4S)-4-[4-[[4-(bromomethyl)phenyl]methoxy]-2-hydroxyphenyl]-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
|---|---|
| PubChem CID | 143466365 |
| Molecular Formula | C32H28BrF2NO4 |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | (4S)-4-[4-[[4-(bromomethyl)phenyl]methoxy]-2-hydroxyphenyl]-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
| SMILES | O=C1C(CCC(O)c2ccc(F)cc2)[C@@H](c2ccc(OCc3ccc(CBr)cc3)cc2O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C32H28BrF2NO4/c33-18-20-1-3-21(4-2-20)19-40-26-13-14-27(30(38)17-26)31-28(15-16-29(37)22-5-7-23(34)8-6-22)32(39)36(31)25-11-9-24(35)10-12-25/h1-14,17,28-29,31,37-38H,15-16,18-19H2/t28?,29?,31-/m1/s1 |
| InChIKey | GVWCMDLNNJMTLU-KHYYVKOXSA-N |
| XLogP | 7.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|