C31H31F2N3O4 — CID 59839605
(4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(4-imidazol-1-ylbutoxy)phenyl]azetidin-2-one (PubChem CID 59839605) has the molecular formula C31H31F2N3O4 and a molecular weight of 547.60 g/mol. Its IUPAC name is (4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(4-imidazol-1-ylbutoxy)phenyl]azetidin-2-one.
| Compound Name | (4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(4-imidazol-1-ylbutoxy)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 59839605 |
| Molecular Formula | C31H31F2N3O4 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[2-hydroxy-4-(4-imidazol-1-ylbutoxy)phenyl]azetidin-2-one |
| SMILES | O=C1C(CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(OCCCCn3ccnc3)cc2O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C31H31F2N3O4/c32-22-5-3-21(4-6-22)28(37)14-13-27-30(36(31(27)39)24-9-7-23(33)8-10-24)26-12-11-25(19-29(26)38)40-18-2-1-16-35-17-15-34-20-35/h3-12,15,17,19-20,27-28,30,37-38H,1-2,13-14,16,18H2/t27?,28-,30+/m0/s1 |
| InChIKey | XKLKKOJARUNSEZ-BZMMJGTGSA-N |
| XLogP | 5.94 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|