C35H46F2N3O5+ — CID 143466368
ethane;[4-[(3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl] 4,4-dimethylpiperazin-4-ium-1-carboxylate (PubChem CID 143466368) has the molecular formula C35H46F2N3O5+ and a molecular weight of 626.77 g/mol. Its IUPAC name is ethane;[4-[(3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl] 4,4-dimethylpiperazin-4-ium-1-carboxylate.
| Compound Name | ethane;[4-[(3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl] 4,4-dimethylpiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 143466368 |
| Molecular Formula | C35H46F2N3O5+ |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | ethane;[4-[(3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]-3-hydroxyphenyl] 4,4-dimethylpiperazin-4-ium-1-carboxylate |
| SMILES | CC.CC.C[N+]1(C)CCN(C(=O)Oc2ccc(C3[C@@H](CCC(O)c4ccc(F)cc4)C(=O)N3c3ccc(F)cc3)c(O)c2)CC1 |
| InChI | InChI=1S/C31H33F2N3O5.2C2H6/c1-36(2)17-15-34(16-18-36)31(40)41-24-11-12-25(28(38)19-24)29-26(13-14-27(37)20-3-5-21(32)6-4-20)30(39)35(29)23-9-7-22(33)8-10-23;2*1-2/h3-12,19,26-27,29,37H,13-18H2,1-2H3;2*1-2H3/p+1/t26-,27?,29?;;/m1../s1 |
| InChIKey | HTHHFXWZSLHHIY-WWMNWPPLSA-O |
| XLogP | 6.83 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|