C24H35N5O — CID 167370527
(6S)-7-cyclopentyl-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]spiro[5H-pyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2'-one (PubChem CID 167370527) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is (6S)-7-cyclopentyl-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]spiro[5H-pyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2'-one.
| Compound Name | (6S)-7-cyclopentyl-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]spiro[5H-pyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 167370527 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (6S)-7-cyclopentyl-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]spiro[5H-pyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2'-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](Nc1ncc3c(n1)N(C1CCCC1)[C@]1(CCNC1=O)C3)C2 |
| InChI | InChI=1S/C24H35N5O/c1-22(2)16-8-9-23(22,3)18(12-16)27-21-26-14-15-13-24(10-11-25-20(24)30)29(19(15)28-21)17-6-4-5-7-17/h14,16-18H,4-13H2,1-3H3,(H,25,30)(H,26,27,28)/t16-,18+,23+,24-/m1/s1 |
| InChIKey | HCFZNQBICGDQPS-FHSQQOBZSA-N |
| XLogP | 3.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |