C37H39N5O6S — CID 167371037
3-[6-[5-[[2,6-dimethoxy-4-(5-methyl-4-oxothieno[3,2-c]pyridin-7-yl)phenyl]methyl]-5,8-diazaspiro[3.5]nonan-8-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167371037) has the molecular formula C37H39N5O6S and a molecular weight of 681.82 g/mol. Its IUPAC name is 3-[6-[5-[[2,6-dimethoxy-4-(5-methyl-4-oxothieno[3,2-c]pyridin-7-yl)phenyl]methyl]-5,8-diazaspiro[3.5]nonan-8-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[[2,6-dimethoxy-4-(5-methyl-4-oxothieno[3,2-c]pyridin-7-yl)phenyl]methyl]-5,8-diazaspiro[3.5]nonan-8-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167371037 |
| Molecular Formula | C37H39N5O6S |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | 3-[6-[5-[[2,6-dimethoxy-4-(5-methyl-4-oxothieno[3,2-c]pyridin-7-yl)phenyl]methyl]-5,8-diazaspiro[3.5]nonan-8-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3ccsc23)cc(OC)c1CN1CCN(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC12CCC2 |
| InChI | InChI=1S/C37H39N5O6S/c1-39-19-27(33-26(35(39)45)9-14-49-33)22-16-30(47-2)28(31(17-22)48-3)20-41-13-12-40(21-37(41)10-4-11-37)24-5-6-25-23(15-24)18-42(36(25)46)29-7-8-32(43)38-34(29)44/h5-6,9,14-17,19,29H,4,7-8,10-13,18,20-21H2,1-3H3,(H,38,43,44) |
| InChIKey | UVKAJEHIISMWCU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|