C48H84N4O14 — CID 167380851
hexyl 3-[2-[2-[5-[2-[2-[bis(3-hexoxy-3-oxopropyl)amino]ethoxy]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]oxyethyl-(3-hexoxy-3-oxopropyl)amino]propanoate (PubChem CID 167380851) has the molecular formula C48H84N4O14 and a molecular weight of 941.21 g/mol. Its IUPAC name is hexyl 3-[2-[2-[5-[2-[2-[bis(3-hexoxy-3-oxopropyl)amino]ethoxy]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]oxyethyl-(3-hexoxy-3-oxopropyl)amino]propanoate.
| Compound Name | hexyl 3-[2-[2-[5-[2-[2-[bis(3-hexoxy-3-oxopropyl)amino]ethoxy]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]oxyethyl-(3-hexoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 167380851 |
| Molecular Formula | C48H84N4O14 |
| Molecular Weight | 941.21 g/mol |
| Exact Mass | 940.60 |
| IUPAC Name | hexyl 3-[2-[2-[5-[2-[2-[bis(3-hexoxy-3-oxopropyl)amino]ethoxy]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]oxyethyl-(3-hexoxy-3-oxopropyl)amino]propanoate |
| SMILES | CCCCCCOC(=O)CCN(CCOC(=O)CC1NC(=O)C(CC(=O)OCCN(CCC(=O)OCCCCCC)CCC(=O)OCCCCCC)NC1=O)CCC(=O)OCCCCCC |
| InChI | InChI=1S/C48H84N4O14/c1-5-9-13-17-31-61-41(53)21-25-51(26-22-42(54)62-32-18-14-10-6-2)29-35-65-45(57)37-39-47(59)50-40(48(60)49-39)38-46(58)66-36-30-52(27-23-43(55)63-33-19-15-11-7-3)28-24-44(56)64-34-20-16-12-8-4/h39-40H,5-38H2,1-4H3,(H,49,60)(H,50,59) |
| InChIKey | IDTXDWGPXRHEIQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 222.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.21 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|