C64H116N4O12S2 — CID 167380936
decyl 3-[2-[2-[5-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethylsulfanyl]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]sulfanylethyl-(3-decoxy-3-oxopropyl)amino]propanoate (PubChem CID 167380936) has the molecular formula C64H116N4O12S2 and a molecular weight of 1197.78 g/mol. Its IUPAC name is decyl 3-[2-[2-[5-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethylsulfanyl]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]sulfanylethyl-(3-decoxy-3-oxopropyl)amino]propanoate.
| Compound Name | decyl 3-[2-[2-[5-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethylsulfanyl]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]sulfanylethyl-(3-decoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 167380936 |
| Molecular Formula | C64H116N4O12S2 |
| Molecular Weight | 1197.78 g/mol |
| Exact Mass | 1196.80 |
| IUPAC Name | decyl 3-[2-[2-[5-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethylsulfanyl]-2-oxoethyl]-3,6-dioxopiperazin-2-yl]acetyl]sulfanylethyl-(3-decoxy-3-oxopropyl)amino]propanoate |
| SMILES | CCCCCCCCCCOC(=O)CCN(CCSC(=O)CC1NC(=O)C(CC(=O)SCCN(CCC(=O)OCCCCCCCCCC)CCC(=O)OCCCCCCCCCC)NC1=O)CCC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C64H116N4O12S2/c1-5-9-13-17-21-25-29-33-47-77-57(69)37-41-67(42-38-58(70)78-48-34-30-26-22-18-14-10-6-2)45-51-81-61(73)53-55-63(75)66-56(64(76)65-55)54-62(74)82-52-46-68(43-39-59(71)79-49-35-31-27-23-19-15-11-7-3)44-40-60(72)80-50-36-32-28-24-20-16-12-8-4/h55-56H,5-54H2,1-4H3,(H,65,76)(H,66,75) |
| InChIKey | LDHZRGKMOHGBSF-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.78 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|