About 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine
1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine (PubChem CID 167387398) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine.
Molecular Properties
| Compound Name | 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine |
| PubChem CID | 167387398 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine |
| SMILES | CN1CC(COC(C)(C)C)(COC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO2/c1-12(2,3)16-10-14(8-15(7)9-14)11-17-13(4,5)6/h8-11H2,1-7H3 |
| InChIKey | NFGDMOSWWSSHNI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine?
The IUPAC name of 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine (CID 167387398) is 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine.
What is the SMILES notation for 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine?
The canonical SMILES for 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine is CN1CC(COC(C)(C)C)(COC(C)(C)C)C1.
What is the InChIKey of 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine?
The InChIKey is NFGDMOSWWSSHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-12(2,3)16-10-14(8-15(7)9-14)11-17-13(4,5)6/h8-11H2,1-7H3.
What are the key properties of 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine?
1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine has a molecular weight of 243.39 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,3-bis[(2-methylpropan-2-yl)oxymethyl]azetidine is sourced from PubChem (CID 167387398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).