C19H38O — CID 70930014
1-(6,6-dimethylheptyl)-1-[(2-methylpropan-2-yl)oxymethyl]cyclopentane (PubChem CID 70930014) has the molecular formula C19H38O and a molecular weight of 282.51 g/mol. Its IUPAC name is 1-(6,6-dimethylheptyl)-1-[(2-methylpropan-2-yl)oxymethyl]cyclopentane.
| Compound Name | 1-(6,6-dimethylheptyl)-1-[(2-methylpropan-2-yl)oxymethyl]cyclopentane |
|---|---|
| PubChem CID | 70930014 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | 1-(6,6-dimethylheptyl)-1-[(2-methylpropan-2-yl)oxymethyl]cyclopentane |
| SMILES | CC(C)(C)CCCCCC1(COC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C19H38O/c1-17(2,3)12-8-7-9-13-19(14-10-11-15-19)16-20-18(4,5)6/h7-16H2,1-6H3 |
| InChIKey | SKEMUWRDPHQUBB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|